C16H13BrN2O2S — CID 162330372
[amino-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]methylidene]azanium bromide (PubChem CID 162330372) has the molecular formula C16H13BrN2O2S and a molecular weight of 377.26 g/mol. Its IUPAC name is [amino-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]methylidene]azanium bromide.
| Compound Name | [amino-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]methylidene]azanium bromide |
|---|---|
| PubChem CID | 162330372 |
| Molecular Formula | C16H13BrN2O2S |
| Molecular Weight | 377.26 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | [amino-[(9,10-dioxoanthracen-2-yl)methylsulfanyl]methylidene]azanium bromide |
| SMILES | NC(=[NH2+])SCc1ccc2c(c1)C(=O)c1ccccc1C2=O.[Br-] |
| InChI | InChI=1S/C16H12N2O2S.BrH/c17-16(18)21-8-9-5-6-12-13(7-9)15(20)11-4-2-1-3-10(11)14(12)19;/h1-7H,8H2,(H3,17,18);1H |
| InChIKey | TWRQDMWSUHUOKE-UHFFFAOYSA-N |
| XLogP | -2.23 |
| TPSA | 85.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.26 |
| LogP ≤ 5 | -2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|