C22H14N4O2S — CID 71343927
2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]anthracene-9,10-dione (PubChem CID 71343927) has the molecular formula C22H14N4O2S and a molecular weight of 398.45 g/mol. Its IUPAC name is 2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]anthracene-9,10-dione.
| Compound Name | 2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]anthracene-9,10-dione |
|---|---|
| PubChem CID | 71343927 |
| Molecular Formula | C22H14N4O2S |
| Molecular Weight | 398.45 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[(1-phenyltetrazol-5-yl)sulfanylmethyl]anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2cc(CSc3nnnn3-c3ccccc3)ccc21 |
| InChI | InChI=1S/C22H14N4O2S/c27-20-16-8-4-5-9-17(16)21(28)19-12-14(10-11-18(19)20)13-29-22-23-24-25-26(22)15-6-2-1-3-7-15/h1-12H,13H2 |
| InChIKey | IKRYFYYQYVUJKB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.45 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|