C15H11F3N4OS — CID 52561620
1-phenyl-5-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]tetrazole (PubChem CID 52561620) has the molecular formula C15H11F3N4OS and a molecular weight of 352.34 g/mol. Its IUPAC name is 1-phenyl-5-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]tetrazole.
| Compound Name | 1-phenyl-5-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 52561620 |
| Molecular Formula | C15H11F3N4OS |
| Molecular Weight | 352.34 g/mol |
| Exact Mass | 352.06 |
| IUPAC Name | 1-phenyl-5-[[4-(trifluoromethoxy)phenyl]methylsulfanyl]tetrazole |
| SMILES | FC(F)(F)Oc1ccc(CSc2nnnn2-c2ccccc2)cc1 |
| InChI | InChI=1S/C15H11F3N4OS/c16-15(17,18)23-13-8-6-11(7-9-13)10-24-14-19-20-21-22(14)12-4-2-1-3-5-12/h1-9H,10H2 |
| InChIKey | WYMQLCLUGXXGSU-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.34 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |