C15H18F3N5OS — CID 8894975
1-[2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylethyl]piperidine (PubChem CID 8894975) has the molecular formula C15H18F3N5OS and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylethyl]piperidine.
| Compound Name | 1-[2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylethyl]piperidine |
|---|---|
| PubChem CID | 8894975 |
| Molecular Formula | C15H18F3N5OS |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | 1-[2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylethyl]piperidine |
| SMILES | FC(F)(F)Oc1ccc(-n2nnnc2SCCN2CCCCC2)cc1 |
| InChI | InChI=1S/C15H18F3N5OS/c16-15(17,18)24-13-6-4-12(5-7-13)23-14(19-20-21-23)25-11-10-22-8-2-1-3-9-22/h4-7H,1-3,8-11H2 |
| InChIKey | QOZBIDZFTUCMPR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |