C11H11F3N4O2S — CID 60912121
4-[5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]tetrazol-1-yl]phenol (PubChem CID 60912121) has the molecular formula C11H11F3N4O2S and a molecular weight of 320.30 g/mol. Its IUPAC name is 4-[5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]tetrazol-1-yl]phenol.
| Compound Name | 4-[5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]tetrazol-1-yl]phenol |
|---|---|
| PubChem CID | 60912121 |
| Molecular Formula | C11H11F3N4O2S |
| Molecular Weight | 320.30 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | 4-[5-[2-(2,2,2-trifluoroethoxy)ethylsulfanyl]tetrazol-1-yl]phenol |
| SMILES | Oc1ccc(-n2nnnc2SCCOCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H11F3N4O2S/c12-11(13,14)7-20-5-6-21-10-15-16-17-18(10)8-1-3-9(19)4-2-8/h1-4,19H,5-7H2 |
| InChIKey | IBLLTJQSACIPRW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|