C13H18N4O3S — CID 60670840
4-[5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanyltetrazol-1-yl]phenol (PubChem CID 60670840) has the molecular formula C13H18N4O3S and a molecular weight of 310.38 g/mol. Its IUPAC name is 4-[5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanyltetrazol-1-yl]phenol.
| Compound Name | 4-[5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanyltetrazol-1-yl]phenol |
|---|---|
| PubChem CID | 60670840 |
| Molecular Formula | C13H18N4O3S |
| Molecular Weight | 310.38 g/mol |
| Exact Mass | 310.11 |
| IUPAC Name | 4-[5-(2-hydroxy-3-propan-2-yloxypropyl)sulfanyltetrazol-1-yl]phenol |
| SMILES | CC(C)OCC(O)CSc1nnnn1-c1ccc(O)cc1 |
| InChI | InChI=1S/C13H18N4O3S/c1-9(2)20-7-12(19)8-21-13-14-15-16-17(13)10-3-5-11(18)6-4-10/h3-6,9,12,18-19H,7-8H2,1-2H3 |
| InChIKey | MGOMGOMVEUMYAB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |