C17H15N5O3S — CID 46690753
4-[2-hydroxy-3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile (PubChem CID 46690753) has the molecular formula C17H15N5O3S and a molecular weight of 369.41 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile.
| Compound Name | 4-[2-hydroxy-3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile |
|---|---|
| PubChem CID | 46690753 |
| Molecular Formula | C17H15N5O3S |
| Molecular Weight | 369.41 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 4-[2-hydroxy-3-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)CSc2nnnn2-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C17H15N5O3S/c18-9-12-1-7-16(8-2-12)25-10-15(24)11-26-17-19-20-21-22(17)13-3-5-14(23)6-4-13/h1-8,15,23-24H,10-11H2 |
| InChIKey | IKINZYSQVGNPSH-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 117.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |