C16H15N5O2S2 — CID 51250401
4-[2-hydroxy-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile (PubChem CID 51250401) has the molecular formula C16H15N5O2S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[2-hydroxy-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile.
| Compound Name | 4-[2-hydroxy-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile |
|---|---|
| PubChem CID | 51250401 |
| Molecular Formula | C16H15N5O2S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | 4-[2-hydroxy-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)CSc2nnnn2Cc2cccs2)cc1 |
| InChI | InChI=1S/C16H15N5O2S2/c17-8-12-3-5-14(6-4-12)23-10-13(22)11-25-16-18-19-20-21(16)9-15-2-1-7-24-15/h1-7,13,22H,9-11H2 |
| InChIKey | JTNMITCBHQEACJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |