C21H19N5OS2 — CID 34079495
(2S)-1-carbazol-9-yl-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropan-2-ol (PubChem CID 34079495) has the molecular formula C21H19N5OS2 and a molecular weight of 421.55 g/mol. Its IUPAC name is (2S)-1-carbazol-9-yl-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropan-2-ol.
| Compound Name | (2S)-1-carbazol-9-yl-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropan-2-ol |
|---|---|
| PubChem CID | 34079495 |
| Molecular Formula | C21H19N5OS2 |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.10 |
| IUPAC Name | (2S)-1-carbazol-9-yl-3-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylpropan-2-ol |
| SMILES | O[C@H](CSc1nnnn1Cc1cccs1)Cn1c2ccccc2c2ccccc21 |
| InChI | InChI=1S/C21H19N5OS2/c27-15(14-29-21-22-23-24-26(21)13-16-6-5-11-28-16)12-25-19-9-3-1-7-17(19)18-8-2-4-10-20(18)25/h1-11,15,27H,12-14H2/t15-/m0/s1 |
| InChIKey | SXVDLRZDRWXLBH-HNNXBMFYSA-N |
| XLogP | 4.04 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |