C14H14N4S2 — CID 47120849
5-[(2-methylphenyl)methylsulfanyl]-1-(thiophen-2-ylmethyl)tetrazole (PubChem CID 47120849) has the molecular formula C14H14N4S2 and a molecular weight of 302.43 g/mol. Its IUPAC name is 5-[(2-methylphenyl)methylsulfanyl]-1-(thiophen-2-ylmethyl)tetrazole.
| Compound Name | 5-[(2-methylphenyl)methylsulfanyl]-1-(thiophen-2-ylmethyl)tetrazole |
|---|---|
| PubChem CID | 47120849 |
| Molecular Formula | C14H14N4S2 |
| Molecular Weight | 302.43 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 5-[(2-methylphenyl)methylsulfanyl]-1-(thiophen-2-ylmethyl)tetrazole |
| SMILES | Cc1ccccc1CSc1nnnn1Cc1cccs1 |
| InChI | InChI=1S/C14H14N4S2/c1-11-5-2-3-6-12(11)10-20-14-15-16-17-18(14)9-13-7-4-8-19-13/h2-8H,9-10H2,1H3 |
| InChIKey | YNVZQXLMNNCFQB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.43 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |