C16H14N6OS2 — CID 135799504
8-methyl-2-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one (PubChem CID 135799504) has the molecular formula C16H14N6OS2 and a molecular weight of 370.46 g/mol. Its IUPAC name is 8-methyl-2-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one.
| Compound Name | 8-methyl-2-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 135799504 |
| Molecular Formula | C16H14N6OS2 |
| Molecular Weight | 370.46 g/mol |
| Exact Mass | 370.07 |
| IUPAC Name | 8-methyl-2-[[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylmethyl]-3H-quinazolin-4-one |
| SMILES | Cc1cccc2c(=O)[nH]c(CSc3nnnn3Cc3cccs3)nc12 |
| InChI | InChI=1S/C16H14N6OS2/c1-10-4-2-6-12-14(10)17-13(18-15(12)23)9-25-16-19-20-21-22(16)8-11-5-3-7-24-11/h2-7H,8-9H2,1H3,(H,17,18,23) |
| InChIKey | KFIFRVFBGAAZIO-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |