C11H10N4O3S — CID 76940561
4-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylbut-2-enoic acid (PubChem CID 76940561) has the molecular formula C11H10N4O3S and a molecular weight of 278.29 g/mol. Its IUPAC name is 4-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylbut-2-enoic acid.
| Compound Name | 4-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylbut-2-enoic acid |
|---|---|
| PubChem CID | 76940561 |
| Molecular Formula | C11H10N4O3S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.05 |
| IUPAC Name | 4-[1-(4-hydroxyphenyl)tetrazol-5-yl]sulfanylbut-2-enoic acid |
| SMILES | O=C(O)C=CCSc1nnnn1-c1ccc(O)cc1 |
| InChI | InChI=1S/C11H10N4O3S/c16-9-5-3-8(4-6-9)15-11(12-13-14-15)19-7-1-2-10(17)18/h1-6,16H,7H2,(H,17,18) |
| InChIKey | NBJGNMIREYZHEI-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 101.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|