C16H11ClF4N4OS — CID 610229
1-(4-chlorophenyl)-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methylsulfanyl]tetrazole (PubChem CID 610229) has the molecular formula C16H11ClF4N4OS and a molecular weight of 418.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methylsulfanyl]tetrazole.
| Compound Name | 1-(4-chlorophenyl)-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methylsulfanyl]tetrazole |
|---|---|
| PubChem CID | 610229 |
| Molecular Formula | C16H11ClF4N4OS |
| Molecular Weight | 418.80 g/mol |
| Exact Mass | 418.03 |
| IUPAC Name | 1-(4-chlorophenyl)-5-[[4-(1,1,2,2-tetrafluoroethoxy)phenyl]methylsulfanyl]tetrazole |
| SMILES | FC(F)C(F)(F)Oc1ccc(CSc2nnnn2-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H11ClF4N4OS/c17-11-3-5-12(6-4-11)25-15(22-23-24-25)27-9-10-1-7-13(8-2-10)26-16(20,21)14(18)19/h1-8,14H,9H2 |
| InChIKey | XOJXKSPIHQEDKC-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.80 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|