C21H15ClFN5OS — CID 46377540
N-(4-chlorophenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide (PubChem CID 46377540) has the molecular formula C21H15ClFN5OS and a molecular weight of 439.90 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide.
| Compound Name | N-(4-chlorophenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 46377540 |
| Molecular Formula | C21H15ClFN5OS |
| Molecular Weight | 439.90 g/mol |
| Exact Mass | 439.07 |
| IUPAC Name | N-(4-chlorophenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1ccc(-n2nnnc2SCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H15ClFN5OS/c22-16-5-9-18(10-6-16)24-20(29)15-3-11-19(12-4-15)28-21(25-26-27-28)30-13-14-1-7-17(23)8-2-14/h1-12H,13H2,(H,24,29) |
| InChIKey | VYEQZUHNYFBYRB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.90 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |