C23H18FN5O2S — CID 46377534
N-(3-acetylphenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide (PubChem CID 46377534) has the molecular formula C23H18FN5O2S and a molecular weight of 447.50 g/mol. Its IUPAC name is N-(3-acetylphenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide.
| Compound Name | N-(3-acetylphenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide |
|---|---|
| PubChem CID | 46377534 |
| Molecular Formula | C23H18FN5O2S |
| Molecular Weight | 447.50 g/mol |
| Exact Mass | 447.12 |
| IUPAC Name | N-(3-acetylphenyl)-4-[5-[(4-fluorophenyl)methylsulfanyl]tetrazol-1-yl]benzamide |
| SMILES | CC(=O)c1cccc(NC(=O)c2ccc(-n3nnnc3SCc3ccc(F)cc3)cc2)c1 |
| InChI | InChI=1S/C23H18FN5O2S/c1-15(30)18-3-2-4-20(13-18)25-22(31)17-7-11-21(12-8-17)29-23(26-27-28-29)32-14-16-5-9-19(24)10-6-16/h2-13H,14H2,1H3,(H,25,31) |
| InChIKey | QDZCJGFOHWQPKR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.50 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |