C14H19N5O3 — CID 102160280
benzyl N-[1-(carbonazidoylamino)-3-methylbutyl]carbamate (PubChem CID 102160280) has the molecular formula C14H19N5O3 and a molecular weight of 305.34 g/mol. Its IUPAC name is benzyl N-[1-(carbonazidoylamino)-3-methylbutyl]carbamate.
| Compound Name | benzyl N-[1-(carbonazidoylamino)-3-methylbutyl]carbamate |
|---|---|
| PubChem CID | 102160280 |
| Molecular Formula | C14H19N5O3 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | benzyl N-[1-(carbonazidoylamino)-3-methylbutyl]carbamate |
| SMILES | CC(C)CC(NC(=O)N=[N+]=[N-])NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H19N5O3/c1-10(2)8-12(16-13(20)18-19-15)17-14(21)22-9-11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | NWKGQEABUADKCV-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 116.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|