C34H35NO2 — CID 100993750
[(R)-1-adamantyl(anthracen-9-yl)methyl] N-[(1R)-1-phenylethyl]carbamate (PubChem CID 100993750) has the molecular formula C34H35NO2 and a molecular weight of 489.66 g/mol. Its IUPAC name is [(R)-1-adamantyl(anthracen-9-yl)methyl] N-[(1R)-1-phenylethyl]carbamate.
| Compound Name | [(R)-1-adamantyl(anthracen-9-yl)methyl] N-[(1R)-1-phenylethyl]carbamate |
|---|---|
| PubChem CID | 100993750 |
| Molecular Formula | C34H35NO2 |
| Molecular Weight | 489.66 g/mol |
| Exact Mass | 489.27 |
| IUPAC Name | [(R)-1-adamantyl(anthracen-9-yl)methyl] N-[(1R)-1-phenylethyl]carbamate |
| SMILES | C[C@@H](NC(=O)O[C@@H](c1c2ccccc2cc2ccccc12)C12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C34H35NO2/c1-22(26-9-3-2-4-10-26)35-33(36)37-32(34-19-23-15-24(20-34)17-25(16-23)21-34)31-29-13-7-5-11-27(29)18-28-12-6-8-14-30(28)31/h2-14,18,22-25,32H,15-17,19-21H2,1H3,(H,35,36)/t22-,23?,24?,25?,32+,34?/m1/s1 |
| InChIKey | JHAUTRRCYWMXLM-NCRSVNRZSA-N |
| XLogP | 8.74 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.66 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|