C29H32N2O2 — CID 4060319
N-[1-(1-adamantyl)ethyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide (PubChem CID 4060319) has the molecular formula C29H32N2O2 and a molecular weight of 440.59 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4060319 |
| Molecular Formula | C29H32N2O2 |
| Molecular Weight | 440.59 g/mol |
| Exact Mass | 440.25 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(4-methoxyphenyl)quinoline-4-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NC(C)C34CC5CC(CC(C5)C3)C4)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H32N2O2/c1-18(29-15-19-11-20(16-29)13-21(12-19)17-29)30-28(32)25-14-27(22-7-9-23(33-2)10-8-22)31-26-6-4-3-5-24(25)26/h3-10,14,18-21H,11-13,15-17H2,1-2H3,(H,30,32) |
| InChIKey | JFMMAJUSEVHOKG-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.59 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |