C24H24N2O4 — CID 55561141
methyl 1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]cyclopentane-1-carboxylate (PubChem CID 55561141) has the molecular formula C24H24N2O4 and a molecular weight of 404.47 g/mol. Its IUPAC name is methyl 1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]cyclopentane-1-carboxylate.
| Compound Name | methyl 1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 55561141 |
| Molecular Formula | C24H24N2O4 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.17 |
| IUPAC Name | methyl 1-[[2-(4-methoxyphenyl)quinoline-4-carbonyl]amino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1(NC(=O)c2cc(-c3ccc(OC)cc3)nc3ccccc23)CCCC1 |
| InChI | InChI=1S/C24H24N2O4/c1-29-17-11-9-16(10-12-17)21-15-19(18-7-3-4-8-20(18)25-21)22(27)26-24(23(28)30-2)13-5-6-14-24/h3-4,7-12,15H,5-6,13-14H2,1-2H3,(H,26,27) |
| InChIKey | SUMDTFBNEPSPDH-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |