C28H28Cl2N2O — CID 4606140
N-[1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)quinoline-4-carboxamide (PubChem CID 4606140) has the molecular formula C28H28Cl2N2O and a molecular weight of 479.45 g/mol. Its IUPAC name is N-[1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)quinoline-4-carboxamide.
| Compound Name | N-[1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 4606140 |
| Molecular Formula | C28H28Cl2N2O |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 478.16 |
| IUPAC Name | N-[1-(1-adamantyl)ethyl]-2-(2,4-dichlorophenyl)quinoline-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(-c2ccc(Cl)cc2Cl)nc2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H28Cl2N2O/c1-16(28-13-17-8-18(14-28)10-19(9-17)15-28)31-27(33)23-12-26(22-7-6-20(29)11-24(22)30)32-25-5-3-2-4-21(23)25/h2-7,11-12,16-19H,8-10,13-15H2,1H3,(H,31,33) |
| InChIKey | MKJYYFIBVJBICJ-UHFFFAOYSA-N |
| XLogP | 7.54 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |