C28H34N4O — CID 19584390
N-[1-(1-adamantyl)propyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide (PubChem CID 19584390) has the molecular formula C28H34N4O and a molecular weight of 442.61 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide |
|---|---|
| PubChem CID | 19584390 |
| Molecular Formula | C28H34N4O |
| Molecular Weight | 442.61 g/mol |
| Exact Mass | 442.27 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carboxamide |
| SMILES | CCC(NC(=O)c1cc(-c2cn(C)nc2C)nc2ccccc12)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C28H34N4O/c1-4-26(28-13-18-9-19(14-28)11-20(10-18)15-28)30-27(33)22-12-25(23-16-32(3)31-17(23)2)29-24-8-6-5-7-21(22)24/h5-8,12,16,18-20,26H,4,9-11,13-15H2,1-3H3,(H,30,33) |
| InChIKey | MNRHHJBECOCSDD-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.61 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |