C21H22N4O3 — CID 19511921
ethyl (E)-3-[[2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carbonyl]amino]but-2-enoate (PubChem CID 19511921) has the molecular formula C21H22N4O3 and a molecular weight of 378.43 g/mol. Its IUPAC name is ethyl (E)-3-[[2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carbonyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-3-[[2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carbonyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 19511921 |
| Molecular Formula | C21H22N4O3 |
| Molecular Weight | 378.43 g/mol |
| Exact Mass | 378.17 |
| IUPAC Name | ethyl (E)-3-[[2-(1,3-dimethylpyrazol-4-yl)quinoline-4-carbonyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C=C(\C)NC(=O)c1cc(-c2cn(C)nc2C)nc2ccccc12 |
| InChI | InChI=1S/C21H22N4O3/c1-5-28-20(26)10-13(2)22-21(27)16-11-19(17-12-25(4)24-14(17)3)23-18-9-7-6-8-15(16)18/h6-12H,5H2,1-4H3,(H,22,27)/b13-10+ |
| InChIKey | KNHZIGHHPMAKFP-JLHYYAGUSA-N |
| XLogP | 3.14 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.43 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|