C25H31NO2 — CID 3935964
N-[1-(1-adamantyl)propyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 3935964) has the molecular formula C25H31NO2 and a molecular weight of 377.53 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 3935964 |
| Molecular Formula | C25H31NO2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | CCC(NC(=O)c1cc2ccccc2cc1OC)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C25H31NO2/c1-3-23(25-13-16-8-17(14-25)10-18(9-16)15-25)26-24(27)21-11-19-6-4-5-7-20(19)12-22(21)28-2/h4-7,11-12,16-18,23H,3,8-10,13-15H2,1-2H3,(H,26,27) |
| InChIKey | NYJZQZCOMQKJSQ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |