C24H36N2O4S — CID 51872779
N-[(1R)-1-(1-adamantyl)propyl]-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide (PubChem CID 51872779) has the molecular formula C24H36N2O4S and a molecular weight of 448.63 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)propyl]-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)propyl]-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 51872779 |
| Molecular Formula | C24H36N2O4S |
| Molecular Weight | 448.63 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)propyl]-4-methoxy-3-(propan-2-ylsulfamoyl)benzamide |
| SMILES | CC[C@@H](NC(=O)c1ccc(OC)c(S(=O)(=O)NC(C)C)c1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C24H36N2O4S/c1-5-22(24-12-16-8-17(13-24)10-18(9-16)14-24)25-23(27)19-6-7-20(30-4)21(11-19)31(28,29)26-15(2)3/h6-7,11,15-18,22,26H,5,8-10,12-14H2,1-4H3,(H,25,27)/t16?,17?,18?,22-,24?/m1/s1 |
| InChIKey | RBZBSWAACYYVRY-YFZSMNHSSA-N |
| XLogP | 4.11 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.63 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |