C22H31ClN2O3S — CID 43011536
N-[1-(1-adamantyl)propyl]-2-chloro-5-(dimethylsulfamoyl)benzamide (PubChem CID 43011536) has the molecular formula C22H31ClN2O3S and a molecular weight of 439.02 g/mol. Its IUPAC name is N-[1-(1-adamantyl)propyl]-2-chloro-5-(dimethylsulfamoyl)benzamide.
| Compound Name | N-[1-(1-adamantyl)propyl]-2-chloro-5-(dimethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 43011536 |
| Molecular Formula | C22H31ClN2O3S |
| Molecular Weight | 439.02 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[1-(1-adamantyl)propyl]-2-chloro-5-(dimethylsulfamoyl)benzamide |
| SMILES | CCC(NC(=O)c1cc(S(=O)(=O)N(C)C)ccc1Cl)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H31ClN2O3S/c1-4-20(22-11-14-7-15(12-22)9-16(8-14)13-22)24-21(26)18-10-17(5-6-19(18)23)29(27,28)25(2)3/h5-6,10,14-16,20H,4,7-9,11-13H2,1-3H3,(H,24,26) |
| InChIKey | BRDHUYVEPNKAPZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.02 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |