C22H31NO4 — CID 7695324
N-[(1R)-1-(1-adamantyl)ethyl]-2,4,5-trimethoxybenzamide (PubChem CID 7695324) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2,4,5-trimethoxybenzamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 7695324 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2,4,5-trimethoxybenzamide |
| SMILES | COc1cc(OC)c(C(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)cc1OC |
| InChI | InChI=1S/C22H31NO4/c1-13(22-10-14-5-15(11-22)7-16(6-14)12-22)23-21(24)17-8-19(26-3)20(27-4)9-18(17)25-2/h8-9,13-16H,5-7,10-12H2,1-4H3,(H,23,24)/t13-,14?,15?,16?,22?/m1/s1 |
| InChIKey | LCGZHRGXGFXCCX-ZHHULCEESA-N |
| XLogP | 4.05 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |