C21H29NO — CID 7929646
N-[(1R)-1-(1-adamantyl)ethyl]-2,3-dimethylbenzamide (PubChem CID 7929646) has the molecular formula C21H29NO and a molecular weight of 311.47 g/mol. Its IUPAC name is N-[(1R)-1-(1-adamantyl)ethyl]-2,3-dimethylbenzamide.
| Compound Name | N-[(1R)-1-(1-adamantyl)ethyl]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 7929646 |
| Molecular Formula | C21H29NO |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.22 |
| IUPAC Name | N-[(1R)-1-(1-adamantyl)ethyl]-2,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N[C@H](C)C23CC4CC(CC(C4)C2)C3)c1C |
| InChI | InChI=1S/C21H29NO/c1-13-5-4-6-19(14(13)2)20(23)22-15(3)21-10-16-7-17(11-21)9-18(8-16)12-21/h4-6,15-18H,7-12H2,1-3H3,(H,22,23)/t15-,16?,17?,18?,21?/m1/s1 |
| InChIKey | YSSMAMLRMPUNBF-NEFAXPCMSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |