C20H29N2O+ — CID 9032231
1-adamantyl-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]azanium (PubChem CID 9032231) has the molecular formula C20H29N2O+ and a molecular weight of 313.46 g/mol. Its IUPAC name is 1-adamantyl-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]azanium.
| Compound Name | 1-adamantyl-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]azanium |
|---|---|
| PubChem CID | 9032231 |
| Molecular Formula | C20H29N2O+ |
| Molecular Weight | 313.46 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | 1-adamantyl-[2-oxo-2-[[(1R)-1-phenylethyl]amino]ethyl]azanium |
| SMILES | C[C@@H](NC(=O)C[NH2+]C12CC3CC(CC(C3)C1)C2)c1ccccc1 |
| InChI | InChI=1S/C20H28N2O/c1-14(18-5-3-2-4-6-18)22-19(23)13-21-20-10-15-7-16(11-20)9-17(8-15)12-20/h2-6,14-17,21H,7-13H2,1H3,(H,22,23)/p+1/t14-,15?,16?,17?,20?/m1/s1 |
| InChIKey | GHQDCMLLQVRFFY-ZIUDEIKKSA-O |
| XLogP | 2.40 |
| TPSA | 45.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |