C13H15N3O4 — CID 87207235
(2,5-dioxopyrrolidin-1-yl) N-[3-(dimethylamino)phenyl]carbamate (PubChem CID 87207235) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) N-[3-(dimethylamino)phenyl]carbamate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) N-[3-(dimethylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 87207235 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) N-[3-(dimethylamino)phenyl]carbamate |
| SMILES | CN(C)c1cccc(NC(=O)ON2C(=O)CCC2=O)c1 |
| InChI | InChI=1S/C13H15N3O4/c1-15(2)10-5-3-4-9(8-10)14-13(19)20-16-11(17)6-7-12(16)18/h3-5,8H,6-7H2,1-2H3,(H,14,19) |
| InChIKey | PHQZQFDCCKDTLV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|