C20H25NO5 — CID 58482193
(2,5-dioxopyrrolidin-1-yl) 8-oxo-10-phenyldecanoate (PubChem CID 58482193) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 8-oxo-10-phenyldecanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 8-oxo-10-phenyldecanoate |
|---|---|
| PubChem CID | 58482193 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 8-oxo-10-phenyldecanoate |
| SMILES | O=C(CCCCCCC(=O)ON1C(=O)CCC1=O)CCc1ccccc1 |
| InChI | InChI=1S/C20H25NO5/c22-17(13-12-16-8-4-3-5-9-16)10-6-1-2-7-11-20(25)26-21-18(23)14-15-19(21)24/h3-5,8-9H,1-2,6-7,10-15H2 |
| InChIKey | UURUGGYHYCYAJM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|