C38H39N3O10 — CID 89211304
(2,5-dioxopyrrolidin-1-yl) 3-[4-[bis(4-methoxyphenyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]methyl]phenyl]propanoate (PubChem CID 89211304) has the molecular formula C38H39N3O10 and a molecular weight of 697.74 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 3-[4-[bis(4-methoxyphenyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]methyl]phenyl]propanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[bis(4-methoxyphenyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]methyl]phenyl]propanoate |
|---|---|
| PubChem CID | 89211304 |
| Molecular Formula | C38H39N3O10 |
| Molecular Weight | 697.74 g/mol |
| Exact Mass | 697.26 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 3-[4-[bis(4-methoxyphenyl)-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]methyl]phenyl]propanoate |
| SMILES | COc1ccc(C(OC[C@@H]2CC[C@H](n3cc(C)c(=O)[nH]c3=O)O2)(c2ccc(CCC(=O)ON3C(=O)CCC3=O)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C38H39N3O10/c1-24-22-40(37(46)39-36(24)45)34-20-17-31(50-34)23-49-38(27-9-13-29(47-2)14-10-27,28-11-15-30(48-3)16-12-28)26-7-4-25(5-8-26)6-21-35(44)51-41-32(42)18-19-33(41)43/h4-5,7-16,22,31,34H,6,17-21,23H2,1-3H3,(H,39,45,46)/t31-,34+/m0/s1 |
| InChIKey | VXOXQADBCWUPRH-AFPLUKJUSA-N |
| XLogP | 4.09 |
| TPSA | 155.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.74 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|