C39H43F3N4O8 — CID 89053501
N-[[1-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide (PubChem CID 89053501) has the molecular formula C39H43F3N4O8 and a molecular weight of 752.79 g/mol. Its IUPAC name is N-[[1-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide.
| Compound Name | N-[[1-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
|---|---|
| PubChem CID | 89053501 |
| Molecular Formula | C39H43F3N4O8 |
| Molecular Weight | 752.79 g/mol |
| Exact Mass | 752.30 |
| IUPAC Name | N-[[1-[(2R,5S)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]methyl]-6-[(2,2,2-trifluoroacetyl)amino]hexanamide |
| SMILES | COc1ccc(C(OC[C@@H]2CC[C@H](n3cc(CNC(=O)CCCCCNC(=O)C(F)(F)F)c(=O)[nH]c3=O)O2)(c2ccccc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C39H43F3N4O8/c1-51-30-16-12-28(13-17-30)38(27-9-5-3-6-10-27,29-14-18-31(52-2)19-15-29)53-25-32-20-21-34(54-32)46-24-26(35(48)45-37(46)50)23-44-33(47)11-7-4-8-22-43-36(49)39(40,41)42/h3,5-6,9-10,12-19,24,32,34H,4,7-8,11,20-23,25H2,1-2H3,(H,43,49)(H,44,47)(H,45,48,50)/t32-,34+/m0/s1 |
| InChIKey | QNRXIDQGJUSNGT-UZNNEEJFSA-N |
| XLogP | 5.10 |
| TPSA | 149.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.79 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|