C27H21N2O9S+ — CID 87524302
1-[4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl]-10-sulfoacridin-10-ium-9-carboxylic acid (PubChem CID 87524302) has the molecular formula C27H21N2O9S+ and a molecular weight of 549.54 g/mol. Its IUPAC name is 1-[4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl]-10-sulfoacridin-10-ium-9-carboxylic acid.
| Compound Name | 1-[4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl]-10-sulfoacridin-10-ium-9-carboxylic acid |
|---|---|
| PubChem CID | 87524302 |
| Molecular Formula | C27H21N2O9S+ |
| Molecular Weight | 549.54 g/mol |
| Exact Mass | 549.10 |
| IUPAC Name | 1-[4-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropyl]phenyl]-10-sulfoacridin-10-ium-9-carboxylic acid |
| SMILES | O=C(CCc1ccc(-c2cccc3c2c(C(=O)O)c2ccccc2[n+]3S(=O)(=O)O)cc1)ON1C(=O)CCC1=O |
| InChI | InChI=1S/C27H20N2O9S/c30-22-13-14-23(31)28(22)38-24(32)15-10-16-8-11-17(12-9-16)18-5-3-7-21-25(18)26(27(33)34)19-4-1-2-6-20(19)29(21)39(35,36)37/h1-9,11-12H,10,13-15H2,(H-,33,34,35,36,37)/p+1 |
| InChIKey | CDQQBVSQURJJKG-UHFFFAOYSA-O |
| XLogP | 2.84 |
| TPSA | 159.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|