C23H20ClNO5S — CID 67440953
methyl 3-[4-[benzoyl-(4-chlorophenyl)sulfamoyl]phenyl]propanoate (PubChem CID 67440953) has the molecular formula C23H20ClNO5S and a molecular weight of 457.94 g/mol. Its IUPAC name is methyl 3-[4-[benzoyl-(4-chlorophenyl)sulfamoyl]phenyl]propanoate.
| Compound Name | methyl 3-[4-[benzoyl-(4-chlorophenyl)sulfamoyl]phenyl]propanoate |
|---|---|
| PubChem CID | 67440953 |
| Molecular Formula | C23H20ClNO5S |
| Molecular Weight | 457.94 g/mol |
| Exact Mass | 457.08 |
| IUPAC Name | methyl 3-[4-[benzoyl-(4-chlorophenyl)sulfamoyl]phenyl]propanoate |
| SMILES | COC(=O)CCc1ccc(S(=O)(=O)N(C(=O)c2ccccc2)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C23H20ClNO5S/c1-30-22(26)16-9-17-7-14-21(15-8-17)31(28,29)25(20-12-10-19(24)11-13-20)23(27)18-5-3-2-4-6-18/h2-8,10-15H,9,16H2,1H3 |
| InChIKey | OJRJUHALOWARAF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.94 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |