C34H36N3O13S3+ — CID 90723995
3-[[4-[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]phenyl]sulfonyl-[10-[3-(trioxidanylsulfanyl)propyl]acridin-10-ium-9-carbonyl]amino]propane-1-sulfonic acid (PubChem CID 90723995) has the molecular formula C34H36N3O13S3+ and a molecular weight of 790.87 g/mol. Its IUPAC name is 3-[[4-[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]phenyl]sulfonyl-[10-[3-(trioxidanylsulfanyl)propyl]acridin-10-ium-9-carbonyl]amino]propane-1-sulfonic acid.
| Compound Name | 3-[[4-[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]phenyl]sulfonyl-[10-[3-(trioxidanylsulfanyl)propyl]acridin-10-ium-9-carbonyl]amino]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 90723995 |
| Molecular Formula | C34H36N3O13S3+ |
| Molecular Weight | 790.87 g/mol |
| Exact Mass | 790.14 |
| IUPAC Name | 3-[[4-[4-(2,5-dihydroxypyrrol-1-yl)oxy-4-oxobutyl]phenyl]sulfonyl-[10-[3-(trioxidanylsulfanyl)propyl]acridin-10-ium-9-carbonyl]amino]propane-1-sulfonic acid |
| SMILES | O=C(CCCc1ccc(S(=O)(=O)N(CCCS(=O)(=O)O)C(=O)c2c3ccccc3[n+](CCCSOOO)c3ccccc23)cc1)On1c(O)ccc1O |
| InChI | InChI=1S/C34H35N3O13S3/c38-30-18-19-31(39)37(30)48-32(40)13-5-8-24-14-16-25(17-15-24)53(46,47)36(21-7-23-52(43,44)45)34(41)33-26-9-1-3-11-28(26)35(20-6-22-51-50-49-42)29-12-4-2-10-27(29)33/h1-4,9-12,14-19H,5-8,13,20-23H2,(H3,41,42,43,44,45)/p+1 |
| InChIKey | ZPYLDELZWDDVRB-UHFFFAOYSA-O |
| XLogP | 4.04 |
| TPSA | 223.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.87 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|