C21H25NO5S — CID 7731199
[2-[butanoyl-(4-methylphenyl)sulfonylamino]phenyl] butanoate (PubChem CID 7731199) has the molecular formula C21H25NO5S and a molecular weight of 403.50 g/mol. Its IUPAC name is [2-[butanoyl-(4-methylphenyl)sulfonylamino]phenyl] butanoate.
| Compound Name | [2-[butanoyl-(4-methylphenyl)sulfonylamino]phenyl] butanoate |
|---|---|
| PubChem CID | 7731199 |
| Molecular Formula | C21H25NO5S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.15 |
| IUPAC Name | [2-[butanoyl-(4-methylphenyl)sulfonylamino]phenyl] butanoate |
| SMILES | CCCC(=O)Oc1ccccc1N(C(=O)CCC)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C21H25NO5S/c1-4-8-20(23)22(28(25,26)17-14-12-16(3)13-15-17)18-10-6-7-11-19(18)27-21(24)9-5-2/h6-7,10-15H,4-5,8-9H2,1-3H3 |
| InChIKey | NLBFOKJWFYUFNU-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|