C18H20ClNO4S — CID 50893461
2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)propanoyl chloride (PubChem CID 50893461) has the molecular formula C18H20ClNO4S and a molecular weight of 381.88 g/mol. Its IUPAC name is 2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)propanoyl chloride.
| Compound Name | 2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)propanoyl chloride |
|---|---|
| PubChem CID | 50893461 |
| Molecular Formula | C18H20ClNO4S |
| Molecular Weight | 381.88 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | 2-(2-ethoxy-N-(4-methylphenyl)sulfonylanilino)propanoyl chloride |
| SMILES | CCOc1ccccc1N(C(C)C(=O)Cl)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H20ClNO4S/c1-4-24-17-8-6-5-7-16(17)20(14(3)18(19)21)25(22,23)15-11-9-13(2)10-12-15/h5-12,14H,4H2,1-3H3 |
| InChIKey | ROLIMLWHRZQQMO-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.88 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|