C17H16Cl3NO4S — CID 50893382
2-(N-(2,5-dichlorophenyl)sulfonyl-2-ethoxyanilino)propanoyl chloride (PubChem CID 50893382) has the molecular formula C17H16Cl3NO4S and a molecular weight of 436.74 g/mol. Its IUPAC name is 2-(N-(2,5-dichlorophenyl)sulfonyl-2-ethoxyanilino)propanoyl chloride.
| Compound Name | 2-(N-(2,5-dichlorophenyl)sulfonyl-2-ethoxyanilino)propanoyl chloride |
|---|---|
| PubChem CID | 50893382 |
| Molecular Formula | C17H16Cl3NO4S |
| Molecular Weight | 436.74 g/mol |
| Exact Mass | 434.99 |
| IUPAC Name | 2-(N-(2,5-dichlorophenyl)sulfonyl-2-ethoxyanilino)propanoyl chloride |
| SMILES | CCOc1ccccc1N(C(C)C(=O)Cl)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H16Cl3NO4S/c1-3-25-15-7-5-4-6-14(15)21(11(2)17(20)22)26(23,24)16-10-12(18)8-9-13(16)19/h4-11H,3H2,1-2H3 |
| InChIKey | HYJYMCQXWFKMKQ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.74 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|