C15H10Cl5NO3S — CID 50892634
2-(2,5-dichloro-N-(3,4-dichlorophenyl)sulfonylanilino)propanoyl chloride (PubChem CID 50892634) has the molecular formula C15H10Cl5NO3S and a molecular weight of 461.58 g/mol. Its IUPAC name is 2-(2,5-dichloro-N-(3,4-dichlorophenyl)sulfonylanilino)propanoyl chloride.
| Compound Name | 2-(2,5-dichloro-N-(3,4-dichlorophenyl)sulfonylanilino)propanoyl chloride |
|---|---|
| PubChem CID | 50892634 |
| Molecular Formula | C15H10Cl5NO3S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 458.88 |
| IUPAC Name | 2-(2,5-dichloro-N-(3,4-dichlorophenyl)sulfonylanilino)propanoyl chloride |
| SMILES | CC(C(=O)Cl)N(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H10Cl5NO3S/c1-8(15(20)22)21(14-6-9(16)2-4-12(14)18)25(23,24)10-3-5-11(17)13(19)7-10/h2-8H,1H3 |
| InChIKey | CYFBJVMYASXKNP-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|