C11H13Cl2NO4S — CID 2985850
methyl 2-(2,5-dichloro-N-methylsulfonylanilino)propanoate (PubChem CID 2985850) has the molecular formula C11H13Cl2NO4S and a molecular weight of 326.20 g/mol. Its IUPAC name is methyl 2-(2,5-dichloro-N-methylsulfonylanilino)propanoate.
| Compound Name | methyl 2-(2,5-dichloro-N-methylsulfonylanilino)propanoate |
|---|---|
| PubChem CID | 2985850 |
| Molecular Formula | C11H13Cl2NO4S |
| Molecular Weight | 326.20 g/mol |
| Exact Mass | 324.99 |
| IUPAC Name | methyl 2-(2,5-dichloro-N-methylsulfonylanilino)propanoate |
| SMILES | COC(=O)C(C)N(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C11H13Cl2NO4S/c1-7(11(15)18-2)14(19(3,16)17)10-6-8(12)4-5-9(10)13/h4-7H,1-3H3 |
| InChIKey | AGKUYGLEXZUULE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.20 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |