C13H16Cl2N2O3S — CID 124561154
(2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-prop-2-enylpropanamide (PubChem CID 124561154) has the molecular formula C13H16Cl2N2O3S and a molecular weight of 351.26 g/mol. Its IUPAC name is (2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-prop-2-enylpropanamide.
| Compound Name | (2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 124561154 |
| Molecular Formula | C13H16Cl2N2O3S |
| Molecular Weight | 351.26 g/mol |
| Exact Mass | 350.03 |
| IUPAC Name | (2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-prop-2-enylpropanamide |
| SMILES | C=CCNC(=O)[C@@H](C)N(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C13H16Cl2N2O3S/c1-4-7-16-13(18)9(2)17(21(3,19)20)12-8-10(14)5-6-11(12)15/h4-6,8-9H,1,7H2,2-3H3,(H,16,18)/t9-/m1/s1 |
| InChIKey | XURKUBBUYPHTNU-SECBINFHSA-N |
| XLogP | 2.45 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.26 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|