C16H24Cl2N2O4S — CID 8991605
(2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3-propan-2-yloxypropyl)propanamide (PubChem CID 8991605) has the molecular formula C16H24Cl2N2O4S and a molecular weight of 411.35 g/mol. Its IUPAC name is (2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3-propan-2-yloxypropyl)propanamide.
| Compound Name | (2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3-propan-2-yloxypropyl)propanamide |
|---|---|
| PubChem CID | 8991605 |
| Molecular Formula | C16H24Cl2N2O4S |
| Molecular Weight | 411.35 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | (2R)-2-(2,5-dichloro-N-methylsulfonylanilino)-N-(3-propan-2-yloxypropyl)propanamide |
| SMILES | CC(C)OCCCNC(=O)[C@@H](C)N(c1cc(Cl)ccc1Cl)S(C)(=O)=O |
| InChI | InChI=1S/C16H24Cl2N2O4S/c1-11(2)24-9-5-8-19-16(21)12(3)20(25(4,22)23)15-10-13(17)6-7-14(15)18/h6-7,10-12H,5,8-9H2,1-4H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | SAJIEIXDXDKODD-GFCCVEGCSA-N |
| XLogP | 3.08 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.35 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|