C15H23ClN2O5S — CID 53281554
2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)propanamide (PubChem CID 53281554) has the molecular formula C15H23ClN2O5S and a molecular weight of 378.88 g/mol. Its IUPAC name is 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)propanamide.
| Compound Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)propanamide |
|---|---|
| PubChem CID | 53281554 |
| Molecular Formula | C15H23ClN2O5S |
| Molecular Weight | 378.88 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 2-(5-chloro-2-methoxy-N-methylsulfonylanilino)-N-(3-methoxypropyl)propanamide |
| SMILES | COCCCNC(=O)C(C)N(c1cc(Cl)ccc1OC)S(C)(=O)=O |
| InChI | InChI=1S/C15H23ClN2O5S/c1-11(15(19)17-8-5-9-22-2)18(24(4,20)21)13-10-12(16)6-7-14(13)23-3/h6-7,10-11H,5,8-9H2,1-4H3,(H,17,19) |
| InChIKey | FFJZFQLYBIZLAJ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.88 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|