C15H23ClN2O4S — CID 124561278
(2R)-N-tert-butyl-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)propanamide (PubChem CID 124561278) has the molecular formula C15H23ClN2O4S and a molecular weight of 362.88 g/mol. Its IUPAC name is (2R)-N-tert-butyl-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)propanamide.
| Compound Name | (2R)-N-tert-butyl-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)propanamide |
|---|---|
| PubChem CID | 124561278 |
| Molecular Formula | C15H23ClN2O4S |
| Molecular Weight | 362.88 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | (2R)-N-tert-butyl-2-(5-chloro-2-methoxy-N-methylsulfonylanilino)propanamide |
| SMILES | COc1ccc(Cl)cc1N([C@H](C)C(=O)NC(C)(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C15H23ClN2O4S/c1-10(14(19)17-15(2,3)4)18(23(6,20)21)12-9-11(16)7-8-13(12)22-5/h7-10H,1-6H3,(H,17,19)/t10-/m1/s1 |
| InChIKey | ZOUAWHFBGWYCMX-SNVBAGLBSA-N |
| XLogP | 2.42 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |