C18H18Cl3NO4S2 — CID 87985860
(5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-3-sulfanylhexanoic acid (PubChem CID 87985860) has the molecular formula C18H18Cl3NO4S2 and a molecular weight of 482.84 g/mol. Its IUPAC name is (5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-3-sulfanylhexanoic acid.
| Compound Name | (5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-3-sulfanylhexanoic acid |
|---|---|
| PubChem CID | 87985860 |
| Molecular Formula | C18H18Cl3NO4S2 |
| Molecular Weight | 482.84 g/mol |
| Exact Mass | 480.97 |
| IUPAC Name | (5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-3-sulfanylhexanoic acid |
| SMILES | C[C@H](CC(S)CC(=O)O)N(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H18Cl3NO4S2/c1-11(8-14(27)10-18(23)24)22(17-9-13(20)4-7-16(17)21)28(25,26)15-5-2-12(19)3-6-15/h2-7,9,11,14,27H,8,10H2,1H3,(H,23,24)/t11-,14?/m1/s1 |
| InChIKey | URPHFODQZDCNGM-YNODCEANSA-N |
| XLogP | 5.39 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.84 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|