C22H25Cl3N2O4S2 — CID 23401698
3-[(5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexyl]-1,3-thiazolidine-2-carboxylic acid (PubChem CID 23401698) has the molecular formula C22H25Cl3N2O4S2 and a molecular weight of 551.95 g/mol. Its IUPAC name is 3-[(5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexyl]-1,3-thiazolidine-2-carboxylic acid.
| Compound Name | 3-[(5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexyl]-1,3-thiazolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 23401698 |
| Molecular Formula | C22H25Cl3N2O4S2 |
| Molecular Weight | 551.95 g/mol |
| Exact Mass | 550.03 |
| IUPAC Name | 3-[(5R)-5-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)hexyl]-1,3-thiazolidine-2-carboxylic acid |
| SMILES | C[C@H](CCCCN1CCSC1C(=O)O)N(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H25Cl3N2O4S2/c1-15(4-2-3-11-26-12-13-32-21(26)22(28)29)27(20-14-17(24)7-10-19(20)25)33(30,31)18-8-5-16(23)6-9-18/h5-10,14-15,21H,2-4,11-13H2,1H3,(H,28,29)/t15-,21?/m1/s1 |
| InChIKey | YCPMZSNOIBVMNS-RBFZIWAESA-N |
| XLogP | 5.86 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.95 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|