C20H20Cl3NO4S2 — CID 87986762
(6R)-6-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-2-methyl-3-sulfanylideneheptanoic acid (PubChem CID 87986762) has the molecular formula C20H20Cl3NO4S2 and a molecular weight of 508.88 g/mol. Its IUPAC name is (6R)-6-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-2-methyl-3-sulfanylideneheptanoic acid.
| Compound Name | (6R)-6-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-2-methyl-3-sulfanylideneheptanoic acid |
|---|---|
| PubChem CID | 87986762 |
| Molecular Formula | C20H20Cl3NO4S2 |
| Molecular Weight | 508.88 g/mol |
| Exact Mass | 506.99 |
| IUPAC Name | (6R)-6-(2,5-dichloro-N-(4-chlorophenyl)sulfonylanilino)-2-methyl-3-sulfanylideneheptanoic acid |
| SMILES | CC(C(=O)O)C(=S)CC[C@@H](C)N(c1cc(Cl)ccc1Cl)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H20Cl3NO4S2/c1-12(3-10-19(29)13(2)20(25)26)24(18-11-15(22)6-9-17(18)23)30(27,28)16-7-4-14(21)5-8-16/h4-9,11-13H,3,10H2,1-2H3,(H,25,26)/t12-,13?/m1/s1 |
| InChIKey | SDRNOYXEAJVALE-PZORYLMUSA-N |
| XLogP | 6.10 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.88 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|