C16H17Cl2FN2O2S — CID 22276002
N-(4-aminobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide (PubChem CID 22276002) has the molecular formula C16H17Cl2FN2O2S and a molecular weight of 391.30 g/mol. Its IUPAC name is N-(4-aminobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide.
| Compound Name | N-(4-aminobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22276002 |
| Molecular Formula | C16H17Cl2FN2O2S |
| Molecular Weight | 391.30 g/mol |
| Exact Mass | 390.04 |
| IUPAC Name | N-(4-aminobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
| SMILES | CC(CCN)N(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H17Cl2FN2O2S/c1-11(8-9-20)21(16-10-13(18)4-7-15(16)19)24(22,23)14-5-2-12(17)3-6-14/h2-7,10-11H,8-9,20H2,1H3 |
| InChIKey | NBJLGMAXHSXZRF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.30 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |