C16H15Cl2FN4O2S — CID 22275969
N-(4-azidobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide (PubChem CID 22275969) has the molecular formula C16H15Cl2FN4O2S and a molecular weight of 417.29 g/mol. Its IUPAC name is N-(4-azidobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide.
| Compound Name | N-(4-azidobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 22275969 |
| Molecular Formula | C16H15Cl2FN4O2S |
| Molecular Weight | 417.29 g/mol |
| Exact Mass | 416.03 |
| IUPAC Name | N-(4-azidobutan-2-yl)-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
| SMILES | CC(CCN=[N+]=[N-])N(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15Cl2FN4O2S/c1-11(8-9-21-22-20)23(16-10-13(18)4-7-15(16)19)26(24,25)14-5-2-12(17)3-6-14/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | UGLBFQQLCRQMFU-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.29 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|