C16H15BrCl2FNO2S — CID 70091590
N-[(3R)-3-bromobutyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide (PubChem CID 70091590) has the molecular formula C16H15BrCl2FNO2S and a molecular weight of 455.18 g/mol. Its IUPAC name is N-[(3R)-3-bromobutyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide.
| Compound Name | N-[(3R)-3-bromobutyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70091590 |
| Molecular Formula | C16H15BrCl2FNO2S |
| Molecular Weight | 455.18 g/mol |
| Exact Mass | 452.94 |
| IUPAC Name | N-[(3R)-3-bromobutyl]-4-chloro-N-(5-chloro-2-fluorophenyl)benzenesulfonamide |
| SMILES | C[C@@H](Br)CCN(c1cc(Cl)ccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H15BrCl2FNO2S/c1-11(17)8-9-21(16-10-13(19)4-7-15(16)20)24(22,23)14-5-2-12(18)3-6-14/h2-7,10-11H,8-9H2,1H3/t11-/m1/s1 |
| InChIKey | QTPAXJJEYGVIFB-LLVKDONJSA-N |
| XLogP | 5.50 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.18 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|